125I-APNEA
Hot Ligand Values Explained
- Hot Ligand ID - A unique identifier for the hot ligand
- Ligand Name - Unique name of the hot ligand
- PubMed Compound ID - Unique Compound ID in PubMed datbase
| Hot Ligand | 481 |
|---|---|
| Ligand Name | 125I-APNEA |
| PubMed Compound ID | 4397 |
| Structure | |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.4 |
| SMILES | C1=CC(=CC=C1CCNC2=C3C(=NC=N2)N(C=N3)C4C(C(C(O4)CO)O)O)N |
| Synonyms | [125I]APNEA (125I)Apnea RefChem:1049338 N6-2-(4-Aminophenyl)ethyladenosine CHEMBL326958 n6-[2-(4-aminophenyl)ethyl]adenosine [3H]N6-2-(4-Aminophenyl)ethyladenosine Lopac0_000118 GTPL417 GTPL462 ChEMBL_198532 SCHEMBL16585344 SCHEMBL29464000 CHEBI:180525 DTXSID301372875 HMS3260G18 Tox21_500118 BDBM50037785 CCG-204213 LP00118 NA72432 SDCCGSBI-0050106.P002 NCGC00015017-02 NCGC00015017-03 NCGC00015017-04 NCGC00015017-05 NCGC00015017-06 NCGC00093612-01 NCGC00093612-02 NCGC00093612-03 NCGC00260803-01 A-202 EU-0100118 L000691 SR-01000075222 SR-01000075222-1 Q27074482 2-(6-{[2-(4-aminophenyl)ethyl]amino}-9H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol 2-{6-[2-(4-Amino-phenyl)-ethylamino]-purin-9-yl}-5-hydroxymethyl-tetrahydro-furan-3,4-diol |
| Created At | Jan 14, 2025 10:59 am |
| Updated At | Jan 14, 2025 10:59 am |